See soorce fer Riboflavin

{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 458451303
| ImageFile = Riboflavin_structure.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Kekulé, skeletal formula of a minor riboflavin (-10-[(2S,3S,4R)-2,3,4-trihydroxypentyl]) tautomer
| ImageFileL1 = Riboflavin-3d.png
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageNameL1 = Spacefill model of a minor riboflavin (-10-[(2S,3S,4R)-2,3,4-trihydroxypentyl]) tautomer
| ImageFileR1 = Riboflavin powder.jpg
| ImageNameR1 = Sample of microcrystaline riboflavin
| IUPACName = 7,8-Dimethyl-10-[(2''S'',3''S'',4''R'')-2,3,4,5-tetrahydroxypentyl]benzo[''g'']pteridine-2,4-dione<ref>{{PubChem|493570}}</ref>
| Section1 = {{Chembox Identifiers
|  CASNo = 83-88-5
|  CASNo_Ref = {{cascite|correct|CAS}}
|  PubChem = 493570
|  PubChem_Ref = {{Pubchemcite|correct|Pubchem}}
|  ChemSpiderID = 431981
|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|  EINECS = 201-507-1
|  UNII_Ref = {{fdacite|correct|FDA}}
|  UNII = TLM2976OFR
|  DrugBank = DB00140
|  DrugBank_Ref = {{drugbankcite|correct|drugbank}}
|  KEGG = D00050
|  KEGG_Ref = {{keggcite|changed|kegg}}
|  MeSHName = Riboflavin
|  ChEBI = 17015
|  ChEBI_Ref = {{ebicite|correct|EBI}}
|  ChEMBL = 511565
|  ChEMBL_Ref = {{ebicite|changed|EBI}}
|  ATCCode_prefix = A11
|  ATCCode_suffix = HA04
|  Beilstein = 97825
|  3DMet = B01201
|  SMILES = O=C2/N=C\1/N(c3cc(c(cc3/N=C/1C(=O)N2)C)C)C[C@H](O)[C@H](O)[C@H](O)CO
|  StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
|  StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N
|  StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
| Section2 = {{Chembox Properties
|  C=17|H=20|N=4|O=6
|  ExactMass = 376.138284392 g mol<sup>-1</sup>
|  Appearance = Orange crystals
|  LogP = 0.095
|  pKa = 9.888
|  pKb = 4.109
}}
| Section3 = {{Chembox Hazards
|  NFPA-H = 1
|  NFPA-F = 1
|  NFPA-R = 0
}}
}}

'''Riboflavin''', forby kent as '''vitamin B<sub>2</sub>''' is an easy absorbit coloured [[micronutrient]] wi a key role in maintainin [[health]] in humans an ainimals. It is the central component o the [[cofactor (biochemistry)|cofactor]]s [[FAD]] an [[Flavin mononucleotide|FMN]], an is syne required bi aw [[flavoprotein]]s. In that wey, vitamin B<sub>2</sub> is required for a wide variety o cellular processes. It plays a key role in energy metabolism, an for the [[metabolism]] o [[fat]]s, [[ketone bodies]], [[carbohydrate]]s, an [[protein]]s.

[[Milk]], [[cheese]], [[leaf vegetable]]s, [[Liver (fuid)|liver]], [[kidney]]s, [[legume]]s, [[baurm]], [[puddock-stuil]]s, an [[awmond]]s<ref name="Higdon 2007">{{Cite web
  | last = Higdon
  | first = Jane
  | authorlink =
  | coauthors = Victoria J. Drake
  | title = Riboflavin
  | work = Micronutrient Information Center
  | publisher = Linus Pauling Institute at Oregon State University
  | year = 2007
  | url = http://lpi.oregonstate.edu/infocenter/vitamins/riboflavin/
  | format =
  | doi =
  | accessdate = December 3, 2009

}}</ref> are guid soorces o vitamin B<sub>2</sub>, but exposure tae licht destroys riboflavin.

The name "riboflavin" comes frae "[[ribose]]" (the succar whase [[reduction (chemistry)|reduced]] fairm, [[ribitol]], fairms pairt o its structur) an "[[Flavin group|flavin]]", the ring-moiety whilk imparts the yellae colour tae the oxidized molecule (frae Latin ''flavus'', "yellae"). The reduced fairm, whilk occurs in metabolism alang wi the oxidised fairm, is colourless.

Riboflavin is baist kent visually as the vitamin whilk imparts the orange colour tae solit B-vitamin preparations, the yellae colour tae vitamin supplement solutions, an the orra fluorescent-yellae colour tae the urine o persons wha supplement wi heich-dose B-complex preparations (nae ither vitamin imparts ony colour tae urine).

Riboflavin can be uised as a deliberate orange-reid fuid colour additive, an is syne designatit in Europe as the [[E nummer]] E101.<ref>{{Cite web| last =| first =| authorlink =| coauthors =| title = Current EU approved additives and their E Numbers| work =| publisher = UK Food Standards Agency| date = July 27, 2007| url = http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist| format =| doi =| accessdate = December 3, 2009}}</ref>

==References ==
{{reflist}}

==Freemit airtins==
*{{pauling|id=vitamins/riboflavin| title=Riboflavin|author=Jane Higdon}}
* [http://www.ebi.ac.uk/pdbe-srv/PDBeXplore/ligand/?ligand=RBF Riboflavin bound to proteins] in the [[Protein Data Bank|PDB]]

{{Vitamin}}

[[Category:Flavins]]
[[Category:B vitamins]]
[[Category:Coenzymes]]
[[Category:Fuid colorins]]